C13H12O — CID 100992447
(9aR,9bS)-8-methyl-9a,9b-dihydrobenzo[e][1]benzofuran (PubChem CID 100992447) has the molecular formula C13H12O and a molecular weight of 184.24 g/mol. Its IUPAC name is (9aR,9bS)-8-methyl-9a,9b-dihydrobenzo[e][1]benzofuran.
| Compound Name | (9aR,9bS)-8-methyl-9a,9b-dihydrobenzo[e][1]benzofuran |
|---|---|
| PubChem CID | 100992447 |
| Molecular Formula | C13H12O |
| Molecular Weight | 184.24 g/mol |
| Exact Mass | 184.09 |
| IUPAC Name | (9aR,9bS)-8-methyl-9a,9b-dihydrobenzo[e][1]benzofuran |
| SMILES | CC1=C[C@H]2C(=CC=C3OC=C[C@@H]32)C=C1 |
| InChI | InChI=1S/C13H12O/c1-9-2-3-10-4-5-13-11(6-7-14-13)12(10)8-9/h2-8,11-12H,1H3/t11-,12+/m1/s1 |
| InChIKey | QVTIWNIHIPMTOF-NEPJUHHUSA-N |
| XLogP | 3.10 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.24 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |