C33H38O4SSi — CID 10099298
[(1S,2S)-1-(benzenesulfinyl)-2-(methoxymethoxy)-3-trityloxypropyl]-trimethylsilane (PubChem CID 10099298) has the molecular formula C33H38O4SSi and a molecular weight of 558.82 g/mol. Its IUPAC name is [(1S,2S)-1-(benzenesulfinyl)-2-(methoxymethoxy)-3-trityloxypropyl]-trimethylsilane.
| Compound Name | [(1S,2S)-1-(benzenesulfinyl)-2-(methoxymethoxy)-3-trityloxypropyl]-trimethylsilane |
|---|---|
| PubChem CID | 10099298 |
| Molecular Formula | C33H38O4SSi |
| Molecular Weight | 558.82 g/mol |
| Exact Mass | 558.23 |
| IUPAC Name | [(1S,2S)-1-(benzenesulfinyl)-2-(methoxymethoxy)-3-trityloxypropyl]-trimethylsilane |
| SMILES | COCO[C@@H](COC(c1ccccc1)(c1ccccc1)c1ccccc1)C(S(=O)c1ccccc1)[Si](C)(C)C |
| InChI | InChI=1S/C33H38O4SSi/c1-35-26-36-31(32(39(2,3)4)38(34)30-23-15-8-16-24-30)25-37-33(27-17-9-5-10-18-27,28-19-11-6-12-20-28)29-21-13-7-14-22-29/h5-24,31-32H,25-26H2,1-4H3/t31-,32?,38?/m0/s1 |
| InChIKey | CRNAVWZMLUMSGF-WGRRYGRBSA-N |
| XLogP | 7.04 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.82 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|