C26H38O7S — CID 134886622
[(1S,6S,7S)-8-(benzenesulfonyl)-6,7-dimethoxy-1-(2-methoxyethoxymethoxy)octyl]benzene (PubChem CID 134886622) has the molecular formula C26H38O7S and a molecular weight of 494.65 g/mol. Its IUPAC name is [(1S,6S,7S)-8-(benzenesulfonyl)-6,7-dimethoxy-1-(2-methoxyethoxymethoxy)octyl]benzene.
| Compound Name | [(1S,6S,7S)-8-(benzenesulfonyl)-6,7-dimethoxy-1-(2-methoxyethoxymethoxy)octyl]benzene |
|---|---|
| PubChem CID | 134886622 |
| Molecular Formula | C26H38O7S |
| Molecular Weight | 494.65 g/mol |
| Exact Mass | 494.23 |
| IUPAC Name | [(1S,6S,7S)-8-(benzenesulfonyl)-6,7-dimethoxy-1-(2-methoxyethoxymethoxy)octyl]benzene |
| SMILES | COCCOCO[C@@H](CCCC[C@H](OC)[C@@H](CS(=O)(=O)c1ccccc1)OC)c1ccccc1 |
| InChI | InChI=1S/C26H38O7S/c1-29-18-19-32-21-33-24(22-12-6-4-7-13-22)16-10-11-17-25(30-2)26(31-3)20-34(27,28)23-14-8-5-9-15-23/h4-9,12-15,24-26H,10-11,16-21H2,1-3H3/t24-,25-,26+/m0/s1 |
| InChIKey | ZBVCSBVAEPZQLC-KKUQBAQOSA-N |
| XLogP | 4.43 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.65 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|