C23H17NO4S — CID 100993333
[5-(4-methylphenyl)sulfonyl-3-phenyl-1,2-oxazol-4-yl]-phenylmethanone (PubChem CID 100993333) has the molecular formula C23H17NO4S and a molecular weight of 403.46 g/mol. Its IUPAC name is [5-(4-methylphenyl)sulfonyl-3-phenyl-1,2-oxazol-4-yl]-phenylmethanone.
| Compound Name | [5-(4-methylphenyl)sulfonyl-3-phenyl-1,2-oxazol-4-yl]-phenylmethanone |
|---|---|
| PubChem CID | 100993333 |
| Molecular Formula | C23H17NO4S |
| Molecular Weight | 403.46 g/mol |
| Exact Mass | 403.09 |
| IUPAC Name | [5-(4-methylphenyl)sulfonyl-3-phenyl-1,2-oxazol-4-yl]-phenylmethanone |
| SMILES | Cc1ccc(S(=O)(=O)c2onc(-c3ccccc3)c2C(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C23H17NO4S/c1-16-12-14-19(15-13-16)29(26,27)23-20(22(25)18-10-6-3-7-11-18)21(24-28-23)17-8-4-2-5-9-17/h2-15H,1H3 |
| InChIKey | WWZOTDHZQQCGGA-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 77.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.46 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |