C29H31NOS — CID 100993895
2-methyl-1-(2-methyl-5-phenylsulfanylpentyl)-3,4-diphenyl-2H-pyrrol-5-one (PubChem CID 100993895) has the molecular formula C29H31NOS and a molecular weight of 441.64 g/mol. Its IUPAC name is 2-methyl-1-(2-methyl-5-phenylsulfanylpentyl)-3,4-diphenyl-2H-pyrrol-5-one.
| Compound Name | 2-methyl-1-(2-methyl-5-phenylsulfanylpentyl)-3,4-diphenyl-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 100993895 |
| Molecular Formula | C29H31NOS |
| Molecular Weight | 441.64 g/mol |
| Exact Mass | 441.21 |
| IUPAC Name | 2-methyl-1-(2-methyl-5-phenylsulfanylpentyl)-3,4-diphenyl-2H-pyrrol-5-one |
| SMILES | CC(CCCSc1ccccc1)CN1C(=O)C(c2ccccc2)=C(c2ccccc2)C1C |
| InChI | InChI=1S/C29H31NOS/c1-22(13-12-20-32-26-18-10-5-11-19-26)21-30-23(2)27(24-14-6-3-7-15-24)28(29(30)31)25-16-8-4-9-17-25/h3-11,14-19,22-23H,12-13,20-21H2,1-2H3 |
| InChIKey | ICFCWNUBFGFFHY-UHFFFAOYSA-N |
| XLogP | 7.04 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.64 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|