C21H28Br2O10 — CID 100995509
dimethyl (1R,2R,3S,4S)-5,6-dibromo-7,7-dimethoxy-1,4-bis(3-methoxy-3-oxopropyl)bicyclo[2.2.1]hept-5-ene-2,3-dicarboxylate (PubChem CID 100995509) has the molecular formula C21H28Br2O10 and a molecular weight of 600.25 g/mol. Its IUPAC name is dimethyl (1R,2R,3S,4S)-5,6-dibromo-7,7-dimethoxy-1,4-bis(3-methoxy-3-oxopropyl)bicyclo[2.2.1]hept-5-ene-2,3-dicarboxylate.
| Compound Name | dimethyl (1R,2R,3S,4S)-5,6-dibromo-7,7-dimethoxy-1,4-bis(3-methoxy-3-oxopropyl)bicyclo[2.2.1]hept-5-ene-2,3-dicarboxylate |
|---|---|
| PubChem CID | 100995509 |
| Molecular Formula | C21H28Br2O10 |
| Molecular Weight | 600.25 g/mol |
| Exact Mass | 598.00 |
| IUPAC Name | dimethyl (1R,2R,3S,4S)-5,6-dibromo-7,7-dimethoxy-1,4-bis(3-methoxy-3-oxopropyl)bicyclo[2.2.1]hept-5-ene-2,3-dicarboxylate |
| SMILES | COC(=O)CC[C@]12C(Br)=C(Br)[C@](CCC(=O)OC)([C@H](C(=O)OC)[C@@H]1C(=O)OC)C2(OC)OC |
| InChI | InChI=1S/C21H28Br2O10/c1-28-11(24)7-9-19-13(17(26)30-3)14(18(27)31-4)20(16(23)15(19)22,10-8-12(25)29-2)21(19,32-5)33-6/h13-14H,7-10H2,1-6H3/t13-,14+,19-,20+ |
| InChIKey | CIHYYTOTSINVJN-YKLJGAPNSA-N |
| XLogP | 2.46 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.25 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|