C21H22N2O8S4 — CID 100996196
5-[7-[(3-carboxy-4-nitrophenyl)disulfanyl]heptyldisulfanyl]-2-nitrobenzoic acid (PubChem CID 100996196) has the molecular formula C21H22N2O8S4 and a molecular weight of 558.68 g/mol. Its IUPAC name is 5-[7-[(3-carboxy-4-nitrophenyl)disulfanyl]heptyldisulfanyl]-2-nitrobenzoic acid.
| Compound Name | 5-[7-[(3-carboxy-4-nitrophenyl)disulfanyl]heptyldisulfanyl]-2-nitrobenzoic acid |
|---|---|
| PubChem CID | 100996196 |
| Molecular Formula | C21H22N2O8S4 |
| Molecular Weight | 558.68 g/mol |
| Exact Mass | 558.03 |
| IUPAC Name | 5-[7-[(3-carboxy-4-nitrophenyl)disulfanyl]heptyldisulfanyl]-2-nitrobenzoic acid |
| SMILES | O=C(O)c1cc(SSCCCCCCCSSc2ccc([N+](=O)[O-])c(C(=O)O)c2)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C21H22N2O8S4/c24-20(25)16-12-14(6-8-18(16)22(28)29)34-32-10-4-2-1-3-5-11-33-35-15-7-9-19(23(30)31)17(13-15)21(26)27/h6-9,12-13H,1-5,10-11H2,(H,24,25)(H,26,27) |
| InChIKey | UKYDWDPTVWSFCW-UHFFFAOYSA-N |
| XLogP | 7.03 |
| TPSA | 160.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.68 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|