C19H23NO9S2 — CID 87695894
2-nitro-5-[[(1S,2R,8S,9R)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]methyldisulfanyl]benzoic acid (PubChem CID 87695894) has the molecular formula C19H23NO9S2 and a molecular weight of 473.53 g/mol. Its IUPAC name is 2-nitro-5-[[(1S,2R,8S,9R)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]methyldisulfanyl]benzoic acid.
| Compound Name | 2-nitro-5-[[(1S,2R,8S,9R)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]methyldisulfanyl]benzoic acid |
|---|---|
| PubChem CID | 87695894 |
| Molecular Formula | C19H23NO9S2 |
| Molecular Weight | 473.53 g/mol |
| Exact Mass | 473.08 |
| IUPAC Name | 2-nitro-5-[[(1S,2R,8S,9R)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]methyldisulfanyl]benzoic acid |
| SMILES | CC1(C)O[C@@H]2[C@H](O1)[C@H]1OC(C)(C)OC1O[C@@H]2CSSc1ccc([N+](=O)[O-])c(C(=O)O)c1 |
| InChI | InChI=1S/C19H23NO9S2/c1-18(2)26-13-12(25-17-15(14(13)27-18)28-19(3,4)29-17)8-30-31-9-5-6-11(20(23)24)10(7-9)16(21)22/h5-7,12-15,17H,8H2,1-4H3,(H,21,22)/t12-,13+,14+,15-,17?/m1/s1 |
| InChIKey | KSLZCACRXXKHNF-CTPYKZEGSA-N |
| XLogP | 3.43 |
| TPSA | 126.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.53 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|