C13H15NO9S2 — CID 87695706
2-nitro-5-[[(2S,3R,4S,5R)-3,4,5,6-tetrahydroxyoxan-2-yl]methyldisulfanyl]benzoic acid (PubChem CID 87695706) has the molecular formula C13H15NO9S2 and a molecular weight of 393.40 g/mol. Its IUPAC name is 2-nitro-5-[[(2S,3R,4S,5R)-3,4,5,6-tetrahydroxyoxan-2-yl]methyldisulfanyl]benzoic acid.
| Compound Name | 2-nitro-5-[[(2S,3R,4S,5R)-3,4,5,6-tetrahydroxyoxan-2-yl]methyldisulfanyl]benzoic acid |
|---|---|
| PubChem CID | 87695706 |
| Molecular Formula | C13H15NO9S2 |
| Molecular Weight | 393.40 g/mol |
| Exact Mass | 393.02 |
| IUPAC Name | 2-nitro-5-[[(2S,3R,4S,5R)-3,4,5,6-tetrahydroxyoxan-2-yl]methyldisulfanyl]benzoic acid |
| SMILES | O=C(O)c1cc(SSC[C@H]2OC(O)[C@H](O)[C@@H](O)[C@H]2O)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C13H15NO9S2/c15-9-8(23-13(20)11(17)10(9)16)4-24-25-5-1-2-7(14(21)22)6(3-5)12(18)19/h1-3,8-11,13,15-17,20H,4H2,(H,18,19)/t8-,9+,10+,11-,13?/m1/s1 |
| InChIKey | ROCAWWRSBYOELE-LPGFFSAWSA-N |
| XLogP | -0.17 |
| TPSA | 170.59 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.40 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|