C40H46O8 — CID 100997384
11,12-bis[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-(2-phenylethyl)-4-prop-2-enyl-10,13-dioxatricyclo[13.2.2.25,8]henicosa-1(18),5,7,15(19),16,20-hexaene-9,14-dione (PubChem CID 100997384) has the molecular formula C40H46O8 and a molecular weight of 654.80 g/mol. Its IUPAC name is 11,12-bis[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-(2-phenylethyl)-4-prop-2-enyl-10,13-dioxatricyclo[13.2.2.25,8]henicosa-1(18),5,7,15(19),16,20-hexaene-9,14-dione.
| Compound Name | 11,12-bis[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-(2-phenylethyl)-4-prop-2-enyl-10,13-dioxatricyclo[13.2.2.25,8]henicosa-1(18),5,7,15(19),16,20-hexaene-9,14-dione |
|---|---|
| PubChem CID | 100997384 |
| Molecular Formula | C40H46O8 |
| Molecular Weight | 654.80 g/mol |
| Exact Mass | 654.32 |
| IUPAC Name | 11,12-bis[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-(2-phenylethyl)-4-prop-2-enyl-10,13-dioxatricyclo[13.2.2.25,8]henicosa-1(18),5,7,15(19),16,20-hexaene-9,14-dione |
| SMILES | C=CCC1CC(CCc2ccccc2)c2ccc(cc2)C(=O)OC([C@H]2COC(C)(C)O2)C([C@H]2COC(C)(C)O2)OC(=O)c2ccc1cc2 |
| InChI | InChI=1S/C40H46O8/c1-6-10-31-23-32(14-13-26-11-8-7-9-12-26)28-17-21-30(22-18-28)38(42)46-36(34-25-44-40(4,5)48-34)35(33-24-43-39(2,3)47-33)45-37(41)29-19-15-27(31)16-20-29/h6-9,11-12,15-22,31-36H,1,10,13-14,23-25H2,2-5H3/t31?,32?,33-,34-,35?,36?/m1/s1 |
| InChIKey | BPGASEUIZGZFGT-COKLJRCYSA-N |
| XLogP | 7.52 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.80 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|