C28H56O12 — CID 10099837
(3R,4S,6R,8R,9S,10R,12R,13S,14S)-1-[(2R,3S,6R)-6-[(2S)-2,4-dihydroxybutyl]-3-methyloxan-2-yl]-9,13-dimethylhexadecane-2,3,4,6,8,10,12,14,15-nonol (PubChem CID 10099837) has the molecular formula C28H56O12 and a molecular weight of 584.74 g/mol. Its IUPAC name is (3R,4S,6R,8R,9S,10R,12R,13S,14S)-1-[(2R,3S,6R)-6-[(2S)-2,4-dihydroxybutyl]-3-methyloxan-2-yl]-9,13-dimethylhexadecane-2,3,4,6,8,10,12,14,15-nonol.
| Compound Name | (3R,4S,6R,8R,9S,10R,12R,13S,14S)-1-[(2R,3S,6R)-6-[(2S)-2,4-dihydroxybutyl]-3-methyloxan-2-yl]-9,13-dimethylhexadecane-2,3,4,6,8,10,12,14,15-nonol |
|---|---|
| PubChem CID | 10099837 |
| Molecular Formula | C28H56O12 |
| Molecular Weight | 584.74 g/mol |
| Exact Mass | 584.38 |
| IUPAC Name | (3R,4S,6R,8R,9S,10R,12R,13S,14S)-1-[(2R,3S,6R)-6-[(2S)-2,4-dihydroxybutyl]-3-methyloxan-2-yl]-9,13-dimethylhexadecane-2,3,4,6,8,10,12,14,15-nonol |
| SMILES | CC(O)[C@@H](O)[C@@H](C)[C@H](O)C[C@@H](O)[C@@H](C)[C@H](O)C[C@@H](O)C[C@H](O)[C@@H](O)C(O)C[C@H]1O[C@@H](C[C@@H](O)CCO)CC[C@@H]1C |
| InChI | InChI=1S/C28H56O12/c1-14-5-6-20(9-18(31)7-8-29)40-26(14)13-25(37)28(39)24(36)11-19(32)10-21(33)15(2)22(34)12-23(35)16(3)27(38)17(4)30/h14-39H,5-13H2,1-4H3/t14-,15-,16-,17?,18-,19+,20+,21+,22+,23+,24-,25?,26+,27-,28+/m0/s1 |
| InChIKey | ARAPIVVMIMPFTF-KCKRCALHSA-N |
| XLogP | -1.60 |
| TPSA | 231.76 Ų |
| H-Bond Donors | 11 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 40 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.74 |
| LogP ≤ 5 | -1.60 |
| H-Bond Donors ≤ 5 | 11 |
| H-Bond Acceptors ≤ 10 | 12 |