C22H14FN3O2 — CID 100999622
methyl 1-(6-fluoroquinolin-2-yl)-9H-pyrido[3,4-b]indole-3-carboxylate (PubChem CID 100999622) has the molecular formula C22H14FN3O2 and a molecular weight of 371.37 g/mol. Its IUPAC name is methyl 1-(6-fluoroquinolin-2-yl)-9H-pyrido[3,4-b]indole-3-carboxylate.
| Compound Name | methyl 1-(6-fluoroquinolin-2-yl)-9H-pyrido[3,4-b]indole-3-carboxylate |
|---|---|
| PubChem CID | 100999622 |
| Molecular Formula | C22H14FN3O2 |
| Molecular Weight | 371.37 g/mol |
| Exact Mass | 371.11 |
| IUPAC Name | methyl 1-(6-fluoroquinolin-2-yl)-9H-pyrido[3,4-b]indole-3-carboxylate |
| SMILES | COC(=O)c1cc2c([nH]c3ccccc32)c(-c2ccc3cc(F)ccc3n2)n1 |
| InChI | InChI=1S/C22H14FN3O2/c1-28-22(27)19-11-15-14-4-2-3-5-17(14)25-20(15)21(26-19)18-8-6-12-10-13(23)7-9-16(12)24-18/h2-11,25H,1H3 |
| InChIKey | OVQXDKMJUVCTSH-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.37 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |