C10H18BrNO4 — CID 101000272
tert-butyl N-[(1S,2R)-1-bromo-2-[(1S)-1,2-dihydroxyethyl]cyclopropyl]carbamate (PubChem CID 101000272) has the molecular formula C10H18BrNO4 and a molecular weight of 296.16 g/mol. Its IUPAC name is tert-butyl N-[(1S,2R)-1-bromo-2-[(1S)-1,2-dihydroxyethyl]cyclopropyl]carbamate.
| Compound Name | tert-butyl N-[(1S,2R)-1-bromo-2-[(1S)-1,2-dihydroxyethyl]cyclopropyl]carbamate |
|---|---|
| PubChem CID | 101000272 |
| Molecular Formula | C10H18BrNO4 |
| Molecular Weight | 296.16 g/mol |
| Exact Mass | 295.04 |
| IUPAC Name | tert-butyl N-[(1S,2R)-1-bromo-2-[(1S)-1,2-dihydroxyethyl]cyclopropyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@]1(Br)C[C@@H]1[C@H](O)CO |
| InChI | InChI=1S/C10H18BrNO4/c1-9(2,3)16-8(15)12-10(11)4-6(10)7(14)5-13/h6-7,13-14H,4-5H2,1-3H3,(H,12,15)/t6-,7-,10-/m1/s1 |
| InChIKey | GLACXUFBJBDAFU-BRDIYROLSA-N |
| XLogP | 0.98 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.16 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|