C13H22N2O2 — CID 84799291
tert-butyl N-[1-(cyanomethyl)-2-propan-2-ylcyclopropyl]carbamate (PubChem CID 84799291) has the molecular formula C13H22N2O2 and a molecular weight of 238.33 g/mol. Its IUPAC name is tert-butyl N-[1-(cyanomethyl)-2-propan-2-ylcyclopropyl]carbamate.
| Compound Name | tert-butyl N-[1-(cyanomethyl)-2-propan-2-ylcyclopropyl]carbamate |
|---|---|
| PubChem CID | 84799291 |
| Molecular Formula | C13H22N2O2 |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.17 |
| IUPAC Name | tert-butyl N-[1-(cyanomethyl)-2-propan-2-ylcyclopropyl]carbamate |
| SMILES | CC(C)C1CC1(CC#N)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C13H22N2O2/c1-9(2)10-8-13(10,6-7-14)15-11(16)17-12(3,4)5/h9-10H,6,8H2,1-5H3,(H,15,16) |
| InChIKey | SSYNTXVRTCNDGR-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |