C11H22N2O4S — CID 102568944
tert-butyl N-[1-(aminomethyl)-2-ethylsulfonylcyclopropyl]carbamate (PubChem CID 102568944) has the molecular formula C11H22N2O4S and a molecular weight of 278.37 g/mol. Its IUPAC name is tert-butyl N-[1-(aminomethyl)-2-ethylsulfonylcyclopropyl]carbamate.
| Compound Name | tert-butyl N-[1-(aminomethyl)-2-ethylsulfonylcyclopropyl]carbamate |
|---|---|
| PubChem CID | 102568944 |
| Molecular Formula | C11H22N2O4S |
| Molecular Weight | 278.37 g/mol |
| Exact Mass | 278.13 |
| IUPAC Name | tert-butyl N-[1-(aminomethyl)-2-ethylsulfonylcyclopropyl]carbamate |
| SMILES | CCS(=O)(=O)C1CC1(CN)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C11H22N2O4S/c1-5-18(15,16)8-6-11(8,7-12)13-9(14)17-10(2,3)4/h8H,5-7,12H2,1-4H3,(H,13,14) |
| InChIKey | OBVVBOSAPFSJAV-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.37 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |