C11H20N2O4S — CID 156832537
tert-butyl N-[3-(aminomethylsulfonyl)-1-bicyclo[1.1.1]pentanyl]carbamate (PubChem CID 156832537) has the molecular formula C11H20N2O4S and a molecular weight of 276.36 g/mol. Its IUPAC name is tert-butyl N-[3-(aminomethylsulfonyl)-1-bicyclo[1.1.1]pentanyl]carbamate.
| Compound Name | tert-butyl N-[3-(aminomethylsulfonyl)-1-bicyclo[1.1.1]pentanyl]carbamate |
|---|---|
| PubChem CID | 156832537 |
| Molecular Formula | C11H20N2O4S |
| Molecular Weight | 276.36 g/mol |
| Exact Mass | 276.11 |
| IUPAC Name | tert-butyl N-[3-(aminomethylsulfonyl)-1-bicyclo[1.1.1]pentanyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC12CC(S(=O)(=O)CN)(C1)C2 |
| InChI | InChI=1S/C11H20N2O4S/c1-9(2,3)17-8(14)13-10-4-11(5-10,6-10)18(15,16)7-12/h4-7,12H2,1-3H3,(H,13,14) |
| InChIKey | BJJZCTXWKRUTSZ-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.36 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |