C11H19NO5S — CID 175968512
[3-[(2-methylpropan-2-yl)oxycarbonylamino]-1-bicyclo[1.1.1]pentanyl] methanesulfonate (PubChem CID 175968512) has the molecular formula C11H19NO5S and a molecular weight of 277.34 g/mol. Its IUPAC name is [3-[(2-methylpropan-2-yl)oxycarbonylamino]-1-bicyclo[1.1.1]pentanyl] methanesulfonate.
| Compound Name | [3-[(2-methylpropan-2-yl)oxycarbonylamino]-1-bicyclo[1.1.1]pentanyl] methanesulfonate |
|---|---|
| PubChem CID | 175968512 |
| Molecular Formula | C11H19NO5S |
| Molecular Weight | 277.34 g/mol |
| Exact Mass | 277.10 |
| IUPAC Name | [3-[(2-methylpropan-2-yl)oxycarbonylamino]-1-bicyclo[1.1.1]pentanyl] methanesulfonate |
| SMILES | CC(C)(C)OC(=O)NC12CC(OS(C)(=O)=O)(C1)C2 |
| InChI | InChI=1S/C11H19NO5S/c1-9(2,3)16-8(13)12-10-5-11(6-10,7-10)17-18(4,14)15/h5-7H2,1-4H3,(H,12,13) |
| InChIKey | ZLWGZCRPPKSEKY-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.34 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|