C16H28N2O2S — CID 174004137
tert-butyl N-[3-(N-tert-butylsulfanyl-C-methylcarbonimidoyl)-1-bicyclo[1.1.1]pentanyl]carbamate (PubChem CID 174004137) has the molecular formula C16H28N2O2S and a molecular weight of 312.48 g/mol. Its IUPAC name is tert-butyl N-[3-(N-tert-butylsulfanyl-C-methylcarbonimidoyl)-1-bicyclo[1.1.1]pentanyl]carbamate.
| Compound Name | tert-butyl N-[3-(N-tert-butylsulfanyl-C-methylcarbonimidoyl)-1-bicyclo[1.1.1]pentanyl]carbamate |
|---|---|
| PubChem CID | 174004137 |
| Molecular Formula | C16H28N2O2S |
| Molecular Weight | 312.48 g/mol |
| Exact Mass | 312.19 |
| IUPAC Name | tert-butyl N-[3-(N-tert-butylsulfanyl-C-methylcarbonimidoyl)-1-bicyclo[1.1.1]pentanyl]carbamate |
| SMILES | CC(=NSC(C)(C)C)C12CC(NC(=O)OC(C)(C)C)(C1)C2 |
| InChI | InChI=1S/C16H28N2O2S/c1-11(18-21-14(5,6)7)15-8-16(9-15,10-15)17-12(19)20-13(2,3)4/h8-10H2,1-7H3,(H,17,19) |
| InChIKey | LMNIOQFUYIEVND-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.48 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|