C12H24N2O2 — CID 163598216
tert-butyl N-[(1R)-2-(aminomethyl)-1-ethylcyclobutyl]carbamate (PubChem CID 163598216) has the molecular formula C12H24N2O2 and a molecular weight of 228.34 g/mol. Its IUPAC name is tert-butyl N-[(1R)-2-(aminomethyl)-1-ethylcyclobutyl]carbamate.
| Compound Name | tert-butyl N-[(1R)-2-(aminomethyl)-1-ethylcyclobutyl]carbamate |
|---|---|
| PubChem CID | 163598216 |
| Molecular Formula | C12H24N2O2 |
| Molecular Weight | 228.34 g/mol |
| Exact Mass | 228.18 |
| IUPAC Name | tert-butyl N-[(1R)-2-(aminomethyl)-1-ethylcyclobutyl]carbamate |
| SMILES | CC[C@@]1(NC(=O)OC(C)(C)C)CCC1CN |
| InChI | InChI=1S/C12H24N2O2/c1-5-12(7-6-9(12)8-13)14-10(15)16-11(2,3)4/h9H,5-8,13H2,1-4H3,(H,14,15)/t9?,12-/m1/s1 |
| InChIKey | GVHXRIPVEHESSB-FFFFSGIJSA-N |
| XLogP | 2.03 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.34 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |