C15H29NO5S — CID 87402659
[(3R)-2,2,3-trimethyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopentyl]methyl methanesulfonate (PubChem CID 87402659) has the molecular formula C15H29NO5S and a molecular weight of 335.47 g/mol. Its IUPAC name is [(3R)-2,2,3-trimethyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopentyl]methyl methanesulfonate.
| Compound Name | [(3R)-2,2,3-trimethyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopentyl]methyl methanesulfonate |
|---|---|
| PubChem CID | 87402659 |
| Molecular Formula | C15H29NO5S |
| Molecular Weight | 335.47 g/mol |
| Exact Mass | 335.18 |
| IUPAC Name | [(3R)-2,2,3-trimethyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopentyl]methyl methanesulfonate |
| SMILES | CC(C)(C)OC(=O)N[C@]1(C)CCC(COS(C)(=O)=O)C1(C)C |
| InChI | InChI=1S/C15H29NO5S/c1-13(2,3)21-12(17)16-15(6)9-8-11(14(15,4)5)10-20-22(7,18)19/h11H,8-10H2,1-7H3,(H,16,17)/t11?,15-/m1/s1 |
| InChIKey | RRVQOVIWNDAFOV-JOPIAHFSSA-N |
| XLogP | 2.68 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.47 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|