C22H27ClNP — CID 101001196
N-[tert-butyl(chloro)phosphanyl]-N-propan-2-yltricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,9,11,13-heptaen-2-amine (PubChem CID 101001196) has the molecular formula C22H27ClNP and a molecular weight of 371.89 g/mol. Its IUPAC name is N-[tert-butyl(chloro)phosphanyl]-N-propan-2-yltricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,9,11,13-heptaen-2-amine.
| Compound Name | N-[tert-butyl(chloro)phosphanyl]-N-propan-2-yltricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,9,11,13-heptaen-2-amine |
|---|---|
| PubChem CID | 101001196 |
| Molecular Formula | C22H27ClNP |
| Molecular Weight | 371.89 g/mol |
| Exact Mass | 371.16 |
| IUPAC Name | N-[tert-butyl(chloro)phosphanyl]-N-propan-2-yltricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,9,11,13-heptaen-2-amine |
| SMILES | CC(C)N(C1c2ccccc2C=Cc2ccccc21)P(Cl)C(C)(C)C |
| InChI | InChI=1S/C22H27ClNP/c1-16(2)24(25(23)22(3,4)5)21-19-12-8-6-10-17(19)14-15-18-11-7-9-13-20(18)21/h6-16,21H,1-5H3 |
| InChIKey | AAXUKDCQYKWQAZ-UHFFFAOYSA-N |
| XLogP | 7.32 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.89 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|