C34H42N2O3 — CID 101001516
[(Z,4S)-4-(dibenzylamino)-6-phenylhex-5-enyl] 2,2,4,4-tetramethyl-1,3-oxazolidine-3-carboxylate (PubChem CID 101001516) has the molecular formula C34H42N2O3 and a molecular weight of 526.72 g/mol. Its IUPAC name is [(Z,4S)-4-(dibenzylamino)-6-phenylhex-5-enyl] 2,2,4,4-tetramethyl-1,3-oxazolidine-3-carboxylate.
| Compound Name | [(Z,4S)-4-(dibenzylamino)-6-phenylhex-5-enyl] 2,2,4,4-tetramethyl-1,3-oxazolidine-3-carboxylate |
|---|---|
| PubChem CID | 101001516 |
| Molecular Formula | C34H42N2O3 |
| Molecular Weight | 526.72 g/mol |
| Exact Mass | 526.32 |
| IUPAC Name | [(Z,4S)-4-(dibenzylamino)-6-phenylhex-5-enyl] 2,2,4,4-tetramethyl-1,3-oxazolidine-3-carboxylate |
| SMILES | CC1(C)COC(C)(C)N1C(=O)OCCC[C@@H](/C=C\c1ccccc1)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C34H42N2O3/c1-33(2)27-39-34(3,4)36(33)32(37)38-24-14-21-31(23-22-28-15-8-5-9-16-28)35(25-29-17-10-6-11-18-29)26-30-19-12-7-13-20-30/h5-13,15-20,22-23,31H,14,21,24-27H2,1-4H3/b23-22-/t31-/m0/s1 |
| InChIKey | JLRCDNBLSACYNR-CXZHOCLDSA-N |
| XLogP | 7.53 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.72 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|