C32H56O5Si3 — CID 10100196
4,4,7,8a-tetramethyl-3,4'-bis(trimethylsilyloxy)-6'-(trimethylsilyloxymethyl)spiro[2,3,4a,5,6,7-hexahydro-1H-naphthalene-8,2'-3H-1-benzofuran]-5'-carbaldehyde (PubChem CID 10100196) has the molecular formula C32H56O5Si3 and a molecular weight of 605.05 g/mol. Its IUPAC name is 4,4,7,8a-tetramethyl-3,4'-bis(trimethylsilyloxy)-6'-(trimethylsilyloxymethyl)spiro[2,3,4a,5,6,7-hexahydro-1H-naphthalene-8,2'-3H-1-benzofuran]-5'-carbaldehyde.
| Compound Name | 4,4,7,8a-tetramethyl-3,4'-bis(trimethylsilyloxy)-6'-(trimethylsilyloxymethyl)spiro[2,3,4a,5,6,7-hexahydro-1H-naphthalene-8,2'-3H-1-benzofuran]-5'-carbaldehyde |
|---|---|
| PubChem CID | 10100196 |
| Molecular Formula | C32H56O5Si3 |
| Molecular Weight | 605.05 g/mol |
| Exact Mass | 604.34 |
| IUPAC Name | 4,4,7,8a-tetramethyl-3,4'-bis(trimethylsilyloxy)-6'-(trimethylsilyloxymethyl)spiro[2,3,4a,5,6,7-hexahydro-1H-naphthalene-8,2'-3H-1-benzofuran]-5'-carbaldehyde |
| SMILES | CC1CCC2C(C)(C)C(O[Si](C)(C)C)CCC2(C)C12Cc1c(cc(CO[Si](C)(C)C)c(C=O)c1O[Si](C)(C)C)O2 |
| InChI | InChI=1S/C32H56O5Si3/c1-22-14-15-27-30(2,3)28(36-39(8,9)10)16-17-31(27,4)32(22)19-24-26(35-32)18-23(21-34-38(5,6)7)25(20-33)29(24)37-40(11,12)13/h18,20,22,27-28H,14-17,19,21H2,1-13H3 |
| InChIKey | WCFRMJURENDOMX-UHFFFAOYSA-N |
| XLogP | 8.83 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.05 |
| LogP ≤ 5 | 8.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|