C17H24O4 — CID 101006247
(2R,4aS,5R,8aR,9aR)-2,9a-dimethoxy-3,4a,5-trimethyl-4,5,8a,9-tetrahydro-2H-benzo[f][1]benzofuran-6-one (PubChem CID 101006247) has the molecular formula C17H24O4 and a molecular weight of 292.38 g/mol. Its IUPAC name is (2R,4aS,5R,8aR,9aR)-2,9a-dimethoxy-3,4a,5-trimethyl-4,5,8a,9-tetrahydro-2H-benzo[f][1]benzofuran-6-one.
| Compound Name | (2R,4aS,5R,8aR,9aR)-2,9a-dimethoxy-3,4a,5-trimethyl-4,5,8a,9-tetrahydro-2H-benzo[f][1]benzofuran-6-one |
|---|---|
| PubChem CID | 101006247 |
| Molecular Formula | C17H24O4 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.17 |
| IUPAC Name | (2R,4aS,5R,8aR,9aR)-2,9a-dimethoxy-3,4a,5-trimethyl-4,5,8a,9-tetrahydro-2H-benzo[f][1]benzofuran-6-one |
| SMILES | CO[C@@H]1O[C@]2(OC)C[C@@H]3C=CC(=O)[C@H](C)[C@@]3(C)CC2=C1C |
| InChI | InChI=1S/C17H24O4/c1-10-13-9-16(3)11(2)14(18)7-6-12(16)8-17(13,20-5)21-15(10)19-4/h6-7,11-12,15H,8-9H2,1-5H3/t11-,12-,15+,16+,17+/m0/s1 |
| InChIKey | NLBGXOVRIUSSEP-SPCAWNFKSA-N |
| XLogP | 2.84 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_misc_A(5)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|