C28H36N2O3Si — CID 101008258
(3R)-3-[(1R,3aS,7aR)-1-hydroxy-3-oxo-3a,4,5,6,7,7a-hexahydro-1H-isoindol-2-yl]-4-[tert-butyl(diphenyl)silyl]oxybutanenitrile (PubChem CID 101008258) has the molecular formula C28H36N2O3Si and a molecular weight of 476.69 g/mol. Its IUPAC name is (3R)-3-[(1R,3aS,7aR)-1-hydroxy-3-oxo-3a,4,5,6,7,7a-hexahydro-1H-isoindol-2-yl]-4-[tert-butyl(diphenyl)silyl]oxybutanenitrile.
| Compound Name | (3R)-3-[(1R,3aS,7aR)-1-hydroxy-3-oxo-3a,4,5,6,7,7a-hexahydro-1H-isoindol-2-yl]-4-[tert-butyl(diphenyl)silyl]oxybutanenitrile |
|---|---|
| PubChem CID | 101008258 |
| Molecular Formula | C28H36N2O3Si |
| Molecular Weight | 476.69 g/mol |
| Exact Mass | 476.25 |
| IUPAC Name | (3R)-3-[(1R,3aS,7aR)-1-hydroxy-3-oxo-3a,4,5,6,7,7a-hexahydro-1H-isoindol-2-yl]-4-[tert-butyl(diphenyl)silyl]oxybutanenitrile |
| SMILES | CC(C)(C)[Si](OC[C@@H](CC#N)N1C(=O)[C@H]2CCCC[C@H]2[C@H]1O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H36N2O3Si/c1-28(2,3)34(22-12-6-4-7-13-22,23-14-8-5-9-15-23)33-20-21(18-19-29)30-26(31)24-16-10-11-17-25(24)27(30)32/h4-9,12-15,21,24-26,31H,10-11,16-18,20H2,1-3H3/t21-,24-,25+,26-/m1/s1 |
| InChIKey | RPIUMTITUJRTTR-ATPOPXNDSA-N |
| XLogP | 3.81 |
| TPSA | 73.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.69 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|