C28H36N2O2Si — CID 10647669
(3R)-3-[(3aR,7aS)-3-oxo-3a,4,5,6,7,7a-hexahydro-1H-isoindol-2-yl]-4-[tert-butyl(diphenyl)silyl]oxybutanenitrile (PubChem CID 10647669) has the molecular formula C28H36N2O2Si and a molecular weight of 460.69 g/mol. Its IUPAC name is (3R)-3-[(3aR,7aS)-3-oxo-3a,4,5,6,7,7a-hexahydro-1H-isoindol-2-yl]-4-[tert-butyl(diphenyl)silyl]oxybutanenitrile.
| Compound Name | (3R)-3-[(3aR,7aS)-3-oxo-3a,4,5,6,7,7a-hexahydro-1H-isoindol-2-yl]-4-[tert-butyl(diphenyl)silyl]oxybutanenitrile |
|---|---|
| PubChem CID | 10647669 |
| Molecular Formula | C28H36N2O2Si |
| Molecular Weight | 460.69 g/mol |
| Exact Mass | 460.25 |
| IUPAC Name | (3R)-3-[(3aR,7aS)-3-oxo-3a,4,5,6,7,7a-hexahydro-1H-isoindol-2-yl]-4-[tert-butyl(diphenyl)silyl]oxybutanenitrile |
| SMILES | CC(C)(C)[Si](OC[C@@H](CC#N)N1C[C@H]2CCCC[C@H]2C1=O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H36N2O2Si/c1-28(2,3)33(24-13-6-4-7-14-24,25-15-8-5-9-16-25)32-21-23(18-19-29)30-20-22-12-10-11-17-26(22)27(30)31/h4-9,13-16,22-23,26H,10-12,17-18,20-21H2,1-3H3/t22-,23-,26-/m1/s1 |
| InChIKey | XGUYFIJTNKDCIF-JQYIIUTOSA-N |
| XLogP | 4.49 |
| TPSA | 53.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.69 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|