C38H41N7O5 — CID 10101025
(2S)-N-[(2S,3S)-3-azido-4-[2-(tert-butylcarbamoyl)phenoxy]-1-phenylbutan-2-yl]-2-[(4-phenylbenzoyl)amino]butanediamide (PubChem CID 10101025) has the molecular formula C38H41N7O5 and a molecular weight of 675.79 g/mol. Its IUPAC name is (2S)-N-[(2S,3S)-3-azido-4-[2-(tert-butylcarbamoyl)phenoxy]-1-phenylbutan-2-yl]-2-[(4-phenylbenzoyl)amino]butanediamide.
| Compound Name | (2S)-N-[(2S,3S)-3-azido-4-[2-(tert-butylcarbamoyl)phenoxy]-1-phenylbutan-2-yl]-2-[(4-phenylbenzoyl)amino]butanediamide |
|---|---|
| PubChem CID | 10101025 |
| Molecular Formula | C38H41N7O5 |
| Molecular Weight | 675.79 g/mol |
| Exact Mass | 675.32 |
| IUPAC Name | (2S)-N-[(2S,3S)-3-azido-4-[2-(tert-butylcarbamoyl)phenoxy]-1-phenylbutan-2-yl]-2-[(4-phenylbenzoyl)amino]butanediamide |
| SMILES | CC(C)(C)NC(=O)c1ccccc1OC[C@@H](N=[N+]=[N-])[C@H](Cc1ccccc1)NC(=O)[C@H](CC(N)=O)NC(=O)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C38H41N7O5/c1-38(2,3)43-36(48)29-16-10-11-17-33(29)50-24-32(44-45-40)30(22-25-12-6-4-7-13-25)41-37(49)31(23-34(39)46)42-35(47)28-20-18-27(19-21-28)26-14-8-5-9-15-26/h4-21,30-32H,22-24H2,1-3H3,(H2,39,46)(H,41,49)(H,42,47)(H,43,48)/t30-,31-,32+/m0/s1 |
| InChIKey | UUZSWJOPJXWRFO-OWHBQTKESA-N |
| XLogP | 5.34 |
| TPSA | 188.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 675.79 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|