C40H39N7O7 — CID 10372754
(2S)-N-[(2S,3S)-3-azido-4-[2-(tert-butylcarbamoyl)phenoxy]-1-phenylbutan-2-yl]-2-[(9,10-dioxoanthracene-2-carbonyl)amino]butanediamide (PubChem CID 10372754) has the molecular formula C40H39N7O7 and a molecular weight of 729.79 g/mol. Its IUPAC name is (2S)-N-[(2S,3S)-3-azido-4-[2-(tert-butylcarbamoyl)phenoxy]-1-phenylbutan-2-yl]-2-[(9,10-dioxoanthracene-2-carbonyl)amino]butanediamide.
| Compound Name | (2S)-N-[(2S,3S)-3-azido-4-[2-(tert-butylcarbamoyl)phenoxy]-1-phenylbutan-2-yl]-2-[(9,10-dioxoanthracene-2-carbonyl)amino]butanediamide |
|---|---|
| PubChem CID | 10372754 |
| Molecular Formula | C40H39N7O7 |
| Molecular Weight | 729.79 g/mol |
| Exact Mass | 729.29 |
| IUPAC Name | (2S)-N-[(2S,3S)-3-azido-4-[2-(tert-butylcarbamoyl)phenoxy]-1-phenylbutan-2-yl]-2-[(9,10-dioxoanthracene-2-carbonyl)amino]butanediamide |
| SMILES | CC(C)(C)NC(=O)c1ccccc1OC[C@@H](N=[N+]=[N-])[C@H](Cc1ccccc1)NC(=O)[C@H](CC(N)=O)NC(=O)c1ccc2c(c1)C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C40H39N7O7/c1-40(2,3)45-38(52)28-15-9-10-16-33(28)54-22-32(46-47-42)30(19-23-11-5-4-6-12-23)43-39(53)31(21-34(41)48)44-37(51)24-17-18-27-29(20-24)36(50)26-14-8-7-13-25(26)35(27)49/h4-18,20,30-32H,19,21-22H2,1-3H3,(H2,41,48)(H,43,53)(H,44,51)(H,45,52)/t30-,31-,32+/m0/s1 |
| InChIKey | CTMLOACHBCWNHW-OWHBQTKESA-N |
| XLogP | 4.45 |
| TPSA | 222.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 54 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 729.79 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|