C28H26N2O5 — CID 69118085
1-phenylpropan-2-yl (2S)-5-amino-5-oxo-2-[(9-oxofluorene-2-carbonyl)amino]pentanoate (PubChem CID 69118085) has the molecular formula C28H26N2O5 and a molecular weight of 470.53 g/mol. Its IUPAC name is 1-phenylpropan-2-yl (2S)-5-amino-5-oxo-2-[(9-oxofluorene-2-carbonyl)amino]pentanoate.
| Compound Name | 1-phenylpropan-2-yl (2S)-5-amino-5-oxo-2-[(9-oxofluorene-2-carbonyl)amino]pentanoate |
|---|---|
| PubChem CID | 69118085 |
| Molecular Formula | C28H26N2O5 |
| Molecular Weight | 470.53 g/mol |
| Exact Mass | 470.18 |
| IUPAC Name | 1-phenylpropan-2-yl (2S)-5-amino-5-oxo-2-[(9-oxofluorene-2-carbonyl)amino]pentanoate |
| SMILES | CC(Cc1ccccc1)OC(=O)[C@H](CCC(N)=O)NC(=O)c1ccc2c(c1)C(=O)c1ccccc1-2 |
| InChI | InChI=1S/C28H26N2O5/c1-17(15-18-7-3-2-4-8-18)35-28(34)24(13-14-25(29)31)30-27(33)19-11-12-21-20-9-5-6-10-22(20)26(32)23(21)16-19/h2-12,16-17,24H,13-15H2,1H3,(H2,29,31)(H,30,33)/t17?,24-/m0/s1 |
| InChIKey | WBVZNCUHQJDSBC-UCSBTNPJSA-N |
| XLogP | 3.44 |
| TPSA | 115.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.53 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |