C24H21N5O3 — CID 10180901
N-[1-amino-3-[4-(diaminomethylideneamino)phenyl]-1-oxopropan-2-yl]-9-oxofluorene-2-carboxamide (PubChem CID 10180901) has the molecular formula C24H21N5O3 and a molecular weight of 427.46 g/mol. Its IUPAC name is N-[1-amino-3-[4-(diaminomethylideneamino)phenyl]-1-oxopropan-2-yl]-9-oxofluorene-2-carboxamide.
| Compound Name | N-[1-amino-3-[4-(diaminomethylideneamino)phenyl]-1-oxopropan-2-yl]-9-oxofluorene-2-carboxamide |
|---|---|
| PubChem CID | 10180901 |
| Molecular Formula | C24H21N5O3 |
| Molecular Weight | 427.46 g/mol |
| Exact Mass | 427.16 |
| IUPAC Name | N-[1-amino-3-[4-(diaminomethylideneamino)phenyl]-1-oxopropan-2-yl]-9-oxofluorene-2-carboxamide |
| SMILES | NC(=O)C(Cc1ccc(N=C(N)N)cc1)NC(=O)c1ccc2c(c1)C(=O)c1ccccc1-2 |
| InChI | InChI=1S/C24H21N5O3/c25-22(31)20(11-13-5-8-15(9-6-13)28-24(26)27)29-23(32)14-7-10-17-16-3-1-2-4-18(16)21(30)19(17)12-14/h1-10,12,20H,11H2,(H2,25,31)(H,29,32)(H4,26,27,28) |
| InChIKey | ULZDNVCNYPLPJV-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 153.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.46 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|