C28H33N7O8S — CID 88633328
4-[[[(2S)-2-[[4-(diaminomethylideneamino)benzoyl]amino]-3-(4-nitrophenyl)propanoyl]amino]methyl]-N,N-dimethylbenzamide;methanesulfonic acid (PubChem CID 88633328) has the molecular formula C28H33N7O8S and a molecular weight of 627.68 g/mol. Its IUPAC name is 4-[[[(2S)-2-[[4-(diaminomethylideneamino)benzoyl]amino]-3-(4-nitrophenyl)propanoyl]amino]methyl]-N,N-dimethylbenzamide;methanesulfonic acid.
| Compound Name | 4-[[[(2S)-2-[[4-(diaminomethylideneamino)benzoyl]amino]-3-(4-nitrophenyl)propanoyl]amino]methyl]-N,N-dimethylbenzamide;methanesulfonic acid |
|---|---|
| PubChem CID | 88633328 |
| Molecular Formula | C28H33N7O8S |
| Molecular Weight | 627.68 g/mol |
| Exact Mass | 627.21 |
| IUPAC Name | 4-[[[(2S)-2-[[4-(diaminomethylideneamino)benzoyl]amino]-3-(4-nitrophenyl)propanoyl]amino]methyl]-N,N-dimethylbenzamide;methanesulfonic acid |
| SMILES | CN(C)C(=O)c1ccc(CNC(=O)[C@H](Cc2ccc([N+](=O)[O-])cc2)NC(=O)c2ccc(N=C(N)N)cc2)cc1.CS(=O)(=O)O |
| InChI | InChI=1S/C27H29N7O5.CH4O3S/c1-33(2)26(37)20-7-3-18(4-8-20)16-30-25(36)23(15-17-5-13-22(14-6-17)34(38)39)32-24(35)19-9-11-21(12-10-19)31-27(28)29;1-5(2,3)4/h3-14,23H,15-16H2,1-2H3,(H,30,36)(H,32,35)(H4,28,29,31);1H3,(H,2,3,4)/t23-;/m0./s1 |
| InChIKey | QNRPIDCTZTYHBL-BQAIUKQQSA-N |
| XLogP | 1.36 |
| TPSA | 240.42 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.68 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|