C35H50O13 — CID 10101049
(1R,3S,4S,5S,6R,7R)-1-(4-acetyloxy-5-methyl-3-methylidene-6-phenylhexyl)-6-decoxy-4,7-dihydroxy-2,8-dioxabicyclo[3.2.1]octane-3,4,5-tricarboxylic acid (PubChem CID 10101049) has the molecular formula C35H50O13 and a molecular weight of 678.77 g/mol. Its IUPAC name is (1R,3S,4S,5S,6R,7R)-1-(4-acetyloxy-5-methyl-3-methylidene-6-phenylhexyl)-6-decoxy-4,7-dihydroxy-2,8-dioxabicyclo[3.2.1]octane-3,4,5-tricarboxylic acid.
| Compound Name | (1R,3S,4S,5S,6R,7R)-1-(4-acetyloxy-5-methyl-3-methylidene-6-phenylhexyl)-6-decoxy-4,7-dihydroxy-2,8-dioxabicyclo[3.2.1]octane-3,4,5-tricarboxylic acid |
|---|---|
| PubChem CID | 10101049 |
| Molecular Formula | C35H50O13 |
| Molecular Weight | 678.77 g/mol |
| Exact Mass | 678.33 |
| IUPAC Name | (1R,3S,4S,5S,6R,7R)-1-(4-acetyloxy-5-methyl-3-methylidene-6-phenylhexyl)-6-decoxy-4,7-dihydroxy-2,8-dioxabicyclo[3.2.1]octane-3,4,5-tricarboxylic acid |
| SMILES | C=C(CC[C@@]12O[C@H](C(=O)O)[C@@](O)(C(=O)O)[C@@](C(=O)O)(O1)[C@H](OCCCCCCCCCC)[C@H]2O)C(OC(C)=O)C(C)Cc1ccccc1 |
| InChI | InChI=1S/C35H50O13/c1-5-6-7-8-9-10-11-15-20-45-28-27(37)33(47-29(30(38)39)34(44,31(40)41)35(28,48-33)32(42)43)19-18-22(2)26(46-24(4)36)23(3)21-25-16-13-12-14-17-25/h12-14,16-17,23,26-29,37,44H,2,5-11,15,18-21H2,1,3-4H3,(H,38,39)(H,40,41)(H,42,43)/t23?,26?,27-,28-,29-,33-,34-,35-/m1/s1 |
| InChIKey | FNWMULOHZKTYNX-XGQKDUIYSA-N |
| XLogP | 3.87 |
| TPSA | 206.35 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.77 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|