C29H37NO14 — CID 10258377
(1R,3S,4S,5S,6R,7R)-1-(4-acetyloxy-5-methyl-3-methylidene-6-phenylhexyl)-6-(4-aminobutanoyloxy)-4,7-dihydroxy-2,8-dioxabicyclo[3.2.1]octane-3,4,5-tricarboxylic acid (PubChem CID 10258377) has the molecular formula C29H37NO14 and a molecular weight of 623.61 g/mol. Its IUPAC name is (1R,3S,4S,5S,6R,7R)-1-(4-acetyloxy-5-methyl-3-methylidene-6-phenylhexyl)-6-(4-aminobutanoyloxy)-4,7-dihydroxy-2,8-dioxabicyclo[3.2.1]octane-3,4,5-tricarboxylic acid.
| Compound Name | (1R,3S,4S,5S,6R,7R)-1-(4-acetyloxy-5-methyl-3-methylidene-6-phenylhexyl)-6-(4-aminobutanoyloxy)-4,7-dihydroxy-2,8-dioxabicyclo[3.2.1]octane-3,4,5-tricarboxylic acid |
|---|---|
| PubChem CID | 10258377 |
| Molecular Formula | C29H37NO14 |
| Molecular Weight | 623.61 g/mol |
| Exact Mass | 623.22 |
| IUPAC Name | (1R,3S,4S,5S,6R,7R)-1-(4-acetyloxy-5-methyl-3-methylidene-6-phenylhexyl)-6-(4-aminobutanoyloxy)-4,7-dihydroxy-2,8-dioxabicyclo[3.2.1]octane-3,4,5-tricarboxylic acid |
| SMILES | C=C(CC[C@@]12O[C@H](C(=O)O)[C@@](O)(C(=O)O)[C@@](C(=O)O)(O1)[C@H](OC(=O)CCCN)[C@H]2O)C(OC(C)=O)C(C)Cc1ccccc1 |
| InChI | InChI=1S/C29H37NO14/c1-15(20(41-17(3)31)16(2)14-18-8-5-4-6-9-18)11-12-27-21(33)22(42-19(32)10-7-13-30)29(44-27,26(38)39)28(40,25(36)37)23(43-27)24(34)35/h4-6,8-9,16,20-23,33,40H,1,7,10-14,30H2,2-3H3,(H,34,35)(H,36,37)(H,38,39)/t16?,20?,21-,22-,23-,27-,28-,29-/m1/s1 |
| InChIKey | GFMFAEYDUQXNOD-QEVRDUMUSA-N |
| XLogP | -0.01 |
| TPSA | 249.44 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.61 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|