C25H33NO11 — CID 10649712
(1S,3R,4S,5R,6R,7R)-1-[(4S,5R)-4-acetyloxy-5-methyl-3-methylidene-6-phenylhexyl]-3-(aminomethyl)-4,6,7-trihydroxy-2,8-dioxabicyclo[3.2.1]octane-4,5-dicarboxylic acid (PubChem CID 10649712) has the molecular formula C25H33NO11 and a molecular weight of 523.54 g/mol. Its IUPAC name is (1S,3R,4S,5R,6R,7R)-1-[(4S,5R)-4-acetyloxy-5-methyl-3-methylidene-6-phenylhexyl]-3-(aminomethyl)-4,6,7-trihydroxy-2,8-dioxabicyclo[3.2.1]octane-4,5-dicarboxylic acid.
| Compound Name | (1S,3R,4S,5R,6R,7R)-1-[(4S,5R)-4-acetyloxy-5-methyl-3-methylidene-6-phenylhexyl]-3-(aminomethyl)-4,6,7-trihydroxy-2,8-dioxabicyclo[3.2.1]octane-4,5-dicarboxylic acid |
|---|---|
| PubChem CID | 10649712 |
| Molecular Formula | C25H33NO11 |
| Molecular Weight | 523.54 g/mol |
| Exact Mass | 523.21 |
| IUPAC Name | (1S,3R,4S,5R,6R,7R)-1-[(4S,5R)-4-acetyloxy-5-methyl-3-methylidene-6-phenylhexyl]-3-(aminomethyl)-4,6,7-trihydroxy-2,8-dioxabicyclo[3.2.1]octane-4,5-dicarboxylic acid |
| SMILES | C=C(CC[C@]12O[C@H](CN)[C@@](O)(C(=O)O)[C@](C(=O)O)(O1)[C@H](O)[C@H]2O)[C@@H](OC(C)=O)[C@H](C)Cc1ccccc1 |
| InChI | InChI=1S/C25H33NO11/c1-13(18(35-15(3)27)14(2)11-16-7-5-4-6-8-16)9-10-23-19(28)20(29)25(37-23,22(32)33)24(34,21(30)31)17(12-26)36-23/h4-8,14,17-20,28-29,34H,1,9-12,26H2,2-3H3,(H,30,31)(H,32,33)/t14-,17-,18-,19-,20-,23+,24-,25+/m1/s1 |
| InChIKey | HOBLRYONHCKQLD-OYIKLAANSA-N |
| XLogP | -0.42 |
| TPSA | 206.07 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.54 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|