C26H32N4O11 — CID 67885794
(1S,3R,4S,5R,6R,7R)-1-(4-acetyloxy-5-methyl-3-methylidene-6-phenylhexyl)-4,6,7-trihydroxy-3-(1-methyltetrazol-5-yl)-2,8-dioxabicyclo[3.2.1]octane-4,5-dicarboxylic acid (PubChem CID 67885794) has the molecular formula C26H32N4O11 and a molecular weight of 576.56 g/mol. Its IUPAC name is (1S,3R,4S,5R,6R,7R)-1-(4-acetyloxy-5-methyl-3-methylidene-6-phenylhexyl)-4,6,7-trihydroxy-3-(1-methyltetrazol-5-yl)-2,8-dioxabicyclo[3.2.1]octane-4,5-dicarboxylic acid.
| Compound Name | (1S,3R,4S,5R,6R,7R)-1-(4-acetyloxy-5-methyl-3-methylidene-6-phenylhexyl)-4,6,7-trihydroxy-3-(1-methyltetrazol-5-yl)-2,8-dioxabicyclo[3.2.1]octane-4,5-dicarboxylic acid |
|---|---|
| PubChem CID | 67885794 |
| Molecular Formula | C26H32N4O11 |
| Molecular Weight | 576.56 g/mol |
| Exact Mass | 576.21 |
| IUPAC Name | (1S,3R,4S,5R,6R,7R)-1-(4-acetyloxy-5-methyl-3-methylidene-6-phenylhexyl)-4,6,7-trihydroxy-3-(1-methyltetrazol-5-yl)-2,8-dioxabicyclo[3.2.1]octane-4,5-dicarboxylic acid |
| SMILES | C=C(CC[C@]12O[C@H](c3nnnn3C)[C@@](O)(C(=O)O)[C@](C(=O)O)(O1)[C@H](O)[C@H]2O)C(OC(C)=O)C(C)Cc1ccccc1 |
| InChI | InChI=1S/C26H32N4O11/c1-13(17(39-15(3)31)14(2)12-16-8-6-5-7-9-16)10-11-24-18(32)19(33)26(41-24,23(36)37)25(38,22(34)35)20(40-24)21-27-28-29-30(21)4/h5-9,14,17-20,32-33,38H,1,10-12H2,2-4H3,(H,34,35)(H,36,37)/t14?,17?,18-,19-,20-,24+,25-,26+/m1/s1 |
| InChIKey | NDRXGSORBIZMII-KYHWJGTJSA-N |
| XLogP | -0.48 |
| TPSA | 223.65 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.56 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|