C39H50O14 — CID 10327679
(1R,3S,4S,5S,6R,7R)-1-(4-acetyloxy-5-methyl-3-methylidene-6-phenylhexyl)-6,7-dihydroxy-4-(8-phenoxyoctoxy)-2,8-dioxabicyclo[3.2.1]octane-3,4,5-tricarboxylic acid (PubChem CID 10327679) has the molecular formula C39H50O14 and a molecular weight of 742.82 g/mol. Its IUPAC name is (1R,3S,4S,5S,6R,7R)-1-(4-acetyloxy-5-methyl-3-methylidene-6-phenylhexyl)-6,7-dihydroxy-4-(8-phenoxyoctoxy)-2,8-dioxabicyclo[3.2.1]octane-3,4,5-tricarboxylic acid.
| Compound Name | (1R,3S,4S,5S,6R,7R)-1-(4-acetyloxy-5-methyl-3-methylidene-6-phenylhexyl)-6,7-dihydroxy-4-(8-phenoxyoctoxy)-2,8-dioxabicyclo[3.2.1]octane-3,4,5-tricarboxylic acid |
|---|---|
| PubChem CID | 10327679 |
| Molecular Formula | C39H50O14 |
| Molecular Weight | 742.82 g/mol |
| Exact Mass | 742.32 |
| IUPAC Name | (1R,3S,4S,5S,6R,7R)-1-(4-acetyloxy-5-methyl-3-methylidene-6-phenylhexyl)-6,7-dihydroxy-4-(8-phenoxyoctoxy)-2,8-dioxabicyclo[3.2.1]octane-3,4,5-tricarboxylic acid |
| SMILES | C=C(CC[C@@]12O[C@H](C(=O)O)[C@@](OCCCCCCCCOc3ccccc3)(C(=O)O)[C@@](C(=O)O)(O1)[C@H](O)[C@H]2O)C(OC(C)=O)C(C)Cc1ccccc1 |
| InChI | InChI=1S/C39H50O14/c1-25(30(51-27(3)40)26(2)24-28-16-10-8-11-17-28)20-21-37-31(41)32(42)38(53-37,35(45)46)39(36(47)48,33(52-37)34(43)44)50-23-15-7-5-4-6-14-22-49-29-18-12-9-13-19-29/h8-13,16-19,26,30-33,41-42H,1,4-7,14-15,20-24H2,2-3H3,(H,43,44)(H,45,46)(H,47,48)/t26?,30?,31-,32-,33-,37-,38-,39-/m1/s1 |
| InChIKey | FYYQAUFNUWLPRI-QMAJIYQSSA-N |
| XLogP | 4.15 |
| TPSA | 215.58 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 742.82 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|