C27H31NO11S — CID 10031077
(1S,3R,4S,5R,6R,7R)-1-[(4S,5R)-4-acetyloxy-5-methyl-3-methylidene-6-phenylhexyl]-4,6,7-trihydroxy-3-(1,3-thiazol-4-yl)-2,8-dioxabicyclo[3.2.1]octane-4,5-dicarboxylic acid (PubChem CID 10031077) has the molecular formula C27H31NO11S and a molecular weight of 577.61 g/mol. Its IUPAC name is (1S,3R,4S,5R,6R,7R)-1-[(4S,5R)-4-acetyloxy-5-methyl-3-methylidene-6-phenylhexyl]-4,6,7-trihydroxy-3-(1,3-thiazol-4-yl)-2,8-dioxabicyclo[3.2.1]octane-4,5-dicarboxylic acid.
| Compound Name | (1S,3R,4S,5R,6R,7R)-1-[(4S,5R)-4-acetyloxy-5-methyl-3-methylidene-6-phenylhexyl]-4,6,7-trihydroxy-3-(1,3-thiazol-4-yl)-2,8-dioxabicyclo[3.2.1]octane-4,5-dicarboxylic acid |
|---|---|
| PubChem CID | 10031077 |
| Molecular Formula | C27H31NO11S |
| Molecular Weight | 577.61 g/mol |
| Exact Mass | 577.16 |
| IUPAC Name | (1S,3R,4S,5R,6R,7R)-1-[(4S,5R)-4-acetyloxy-5-methyl-3-methylidene-6-phenylhexyl]-4,6,7-trihydroxy-3-(1,3-thiazol-4-yl)-2,8-dioxabicyclo[3.2.1]octane-4,5-dicarboxylic acid |
| SMILES | C=C(CC[C@]12O[C@H](c3cscn3)[C@@](O)(C(=O)O)[C@](C(=O)O)(O1)[C@H](O)[C@H]2O)[C@@H](OC(C)=O)[C@H](C)Cc1ccccc1 |
| InChI | InChI=1S/C27H31NO11S/c1-14(19(37-16(3)29)15(2)11-17-7-5-4-6-8-17)9-10-25-20(30)21(31)27(39-25,24(34)35)26(36,23(32)33)22(38-25)18-12-40-13-28-18/h4-8,12-13,15,19-22,30-31,36H,1,9-11H2,2-3H3,(H,32,33)(H,34,35)/t15-,19-,20-,21-,22-,25+,26-,27+/m1/s1 |
| InChIKey | IDJHRLOKBIPZSC-UWKURYEASA-N |
| XLogP | 1.45 |
| TPSA | 192.94 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.61 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|