C39H56O17 — CID 67755790
1-(4-acetyloxy-5-methyl-3-methylidene-6-phenylhexyl)-4-hydroxy-7-(2-methoxyethoxymethoxy)-6-nonoxycarbonyloxy-2,8-dioxabicyclo[3.2.1]octane-3,4,5-tricarboxylic acid (PubChem CID 67755790) has the molecular formula C39H56O17 and a molecular weight of 796.86 g/mol. Its IUPAC name is 1-(4-acetyloxy-5-methyl-3-methylidene-6-phenylhexyl)-4-hydroxy-7-(2-methoxyethoxymethoxy)-6-nonoxycarbonyloxy-2,8-dioxabicyclo[3.2.1]octane-3,4,5-tricarboxylic acid.
| Compound Name | 1-(4-acetyloxy-5-methyl-3-methylidene-6-phenylhexyl)-4-hydroxy-7-(2-methoxyethoxymethoxy)-6-nonoxycarbonyloxy-2,8-dioxabicyclo[3.2.1]octane-3,4,5-tricarboxylic acid |
|---|---|
| PubChem CID | 67755790 |
| Molecular Formula | C39H56O17 |
| Molecular Weight | 796.86 g/mol |
| Exact Mass | 796.35 |
| IUPAC Name | 1-(4-acetyloxy-5-methyl-3-methylidene-6-phenylhexyl)-4-hydroxy-7-(2-methoxyethoxymethoxy)-6-nonoxycarbonyloxy-2,8-dioxabicyclo[3.2.1]octane-3,4,5-tricarboxylic acid |
| SMILES | C=C(CCC12OC(C(=O)O)C(O)(C(=O)O)C(C(=O)O)(O1)C(OC(=O)OCCCCCCCCC)C2OCOCCOC)C(OC(C)=O)C(C)Cc1ccccc1 |
| InChI | InChI=1S/C39H56O17/c1-6-7-8-9-10-11-15-20-51-36(47)54-31-30(52-24-50-22-21-49-5)37(55-32(33(41)42)38(48,34(43)44)39(31,56-37)35(45)46)19-18-25(2)29(53-27(4)40)26(3)23-28-16-13-12-14-17-28/h12-14,16-17,26,29-32,48H,2,6-11,15,18-24H2,1,3-5H3,(H,41,42)(H,43,44)(H,45,46) |
| InChIKey | KEADFLKOHNTCOI-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 240.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 796.86 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|