C32H43NO16 — CID 67755795
1-(4-acetyloxy-5-methyl-3-methylidene-6-phenylhexyl)-6-(ethylcarbamoyloxy)-4-hydroxy-7-(2-methoxyethoxymethoxy)-2,8-dioxabicyclo[3.2.1]octane-3,4,5-tricarboxylic acid (PubChem CID 67755795) has the molecular formula C32H43NO16 and a molecular weight of 697.69 g/mol. Its IUPAC name is 1-(4-acetyloxy-5-methyl-3-methylidene-6-phenylhexyl)-6-(ethylcarbamoyloxy)-4-hydroxy-7-(2-methoxyethoxymethoxy)-2,8-dioxabicyclo[3.2.1]octane-3,4,5-tricarboxylic acid.
| Compound Name | 1-(4-acetyloxy-5-methyl-3-methylidene-6-phenylhexyl)-6-(ethylcarbamoyloxy)-4-hydroxy-7-(2-methoxyethoxymethoxy)-2,8-dioxabicyclo[3.2.1]octane-3,4,5-tricarboxylic acid |
|---|---|
| PubChem CID | 67755795 |
| Molecular Formula | C32H43NO16 |
| Molecular Weight | 697.69 g/mol |
| Exact Mass | 697.26 |
| IUPAC Name | 1-(4-acetyloxy-5-methyl-3-methylidene-6-phenylhexyl)-6-(ethylcarbamoyloxy)-4-hydroxy-7-(2-methoxyethoxymethoxy)-2,8-dioxabicyclo[3.2.1]octane-3,4,5-tricarboxylic acid |
| SMILES | C=C(CCC12OC(C(=O)O)C(O)(C(=O)O)C(C(=O)O)(O1)C(OC(=O)NCC)C2OCOCCOC)C(OC(C)=O)C(C)Cc1ccccc1 |
| InChI | InChI=1S/C32H43NO16/c1-6-33-29(41)47-24-23(45-17-44-15-14-43-5)30(48-25(26(35)36)31(42,27(37)38)32(24,49-30)28(39)40)13-12-18(2)22(46-20(4)34)19(3)16-21-10-8-7-9-11-21/h7-11,19,22-25,42H,2,6,12-17H2,1,3-5H3,(H,33,41)(H,35,36)(H,37,38)(H,39,40) |
| InChIKey | XODWKMSPYAUOOQ-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 242.91 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 697.69 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|