C12H20O8 — CID 101011011
(2S,3S,4S,5R,6R)-3,4,5-trihydroxy-6-(5-oxohexan-2-yloxy)oxane-2-carboxylic acid (PubChem CID 101011011) has the molecular formula C12H20O8 and a molecular weight of 292.28 g/mol. Its IUPAC name is (2S,3S,4S,5R,6R)-3,4,5-trihydroxy-6-(5-oxohexan-2-yloxy)oxane-2-carboxylic acid.
| Compound Name | (2S,3S,4S,5R,6R)-3,4,5-trihydroxy-6-(5-oxohexan-2-yloxy)oxane-2-carboxylic acid |
|---|---|
| PubChem CID | 101011011 |
| Molecular Formula | C12H20O8 |
| Molecular Weight | 292.28 g/mol |
| Exact Mass | 292.12 |
| IUPAC Name | (2S,3S,4S,5R,6R)-3,4,5-trihydroxy-6-(5-oxohexan-2-yloxy)oxane-2-carboxylic acid |
| SMILES | CC(=O)CCC(C)O[C@@H]1O[C@H](C(=O)O)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C12H20O8/c1-5(13)3-4-6(2)19-12-9(16)7(14)8(15)10(20-12)11(17)18/h6-10,12,14-16H,3-4H2,1-2H3,(H,17,18)/t6?,7-,8-,9+,10-,12+/m0/s1 |
| InChIKey | USLGFVSKVXGNTA-GEBOREBZSA-N |
| XLogP | -1.35 |
| TPSA | 133.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.28 |
| LogP ≤ 5 | -1.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |