C10H19NO6 — CID 163647847
(3S,5S,6R)-6-butan-2-yloxy-3,4,5-trihydroxyoxane-2-carboxamide (PubChem CID 163647847) has the molecular formula C10H19NO6 and a molecular weight of 249.26 g/mol. Its IUPAC name is (3S,5S,6R)-6-butan-2-yloxy-3,4,5-trihydroxyoxane-2-carboxamide.
| Compound Name | (3S,5S,6R)-6-butan-2-yloxy-3,4,5-trihydroxyoxane-2-carboxamide |
|---|---|
| PubChem CID | 163647847 |
| Molecular Formula | C10H19NO6 |
| Molecular Weight | 249.26 g/mol |
| Exact Mass | 249.12 |
| IUPAC Name | (3S,5S,6R)-6-butan-2-yloxy-3,4,5-trihydroxyoxane-2-carboxamide |
| SMILES | CCC(C)O[C@@H]1OC(C(N)=O)[C@@H](O)C(O)[C@@H]1O |
| InChI | InChI=1S/C10H19NO6/c1-3-4(2)16-10-7(14)5(12)6(13)8(17-10)9(11)15/h4-8,10,12-14H,3H2,1-2H3,(H2,11,15)/t4?,5?,6-,7-,8?,10+/m0/s1 |
| InChIKey | XYPGSLVHNQEGDA-GBVQLCOASA-N |
| XLogP | -1.91 |
| TPSA | 122.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.26 |
| LogP ≤ 5 | -1.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |