C11H20INO5 — CID 166802326
4,5-dihydroxy-6-(1-iodoethoxy)-3-propan-2-yloxane-2-carboxamide (PubChem CID 166802326) has the molecular formula C11H20INO5 and a molecular weight of 373.19 g/mol. Its IUPAC name is 4,5-dihydroxy-6-(1-iodoethoxy)-3-propan-2-yloxane-2-carboxamide.
| Compound Name | 4,5-dihydroxy-6-(1-iodoethoxy)-3-propan-2-yloxane-2-carboxamide |
|---|---|
| PubChem CID | 166802326 |
| Molecular Formula | C11H20INO5 |
| Molecular Weight | 373.19 g/mol |
| Exact Mass | 373.04 |
| IUPAC Name | 4,5-dihydroxy-6-(1-iodoethoxy)-3-propan-2-yloxane-2-carboxamide |
| SMILES | CC(I)OC1OC(C(N)=O)C(C(C)C)C(O)C1O |
| InChI | InChI=1S/C11H20INO5/c1-4(2)6-7(14)8(15)11(17-5(3)12)18-9(6)10(13)16/h4-9,11,14-15H,1-3H3,(H2,13,16) |
| InChIKey | CQRSSSPXRADAFM-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.19 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|