C24H35N2O4P — CID 101011767
diethyl 3,4,5,6,7-pentamethyl-8-piperidin-1-yl-9-aza-10-phosphatetracyclo[4.4.0.02,10.03,7]deca-4,8-diene-1,2-dicarboxylate (PubChem CID 101011767) has the molecular formula C24H35N2O4P and a molecular weight of 446.53 g/mol. Its IUPAC name is diethyl 3,4,5,6,7-pentamethyl-8-piperidin-1-yl-9-aza-10-phosphatetracyclo[4.4.0.02,10.03,7]deca-4,8-diene-1,2-dicarboxylate.
| Compound Name | diethyl 3,4,5,6,7-pentamethyl-8-piperidin-1-yl-9-aza-10-phosphatetracyclo[4.4.0.02,10.03,7]deca-4,8-diene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 101011767 |
| Molecular Formula | C24H35N2O4P |
| Molecular Weight | 446.53 g/mol |
| Exact Mass | 446.23 |
| IUPAC Name | diethyl 3,4,5,6,7-pentamethyl-8-piperidin-1-yl-9-aza-10-phosphatetracyclo[4.4.0.02,10.03,7]deca-4,8-diene-1,2-dicarboxylate |
| SMILES | CCOC(=O)C12P3N=C(N4CCCCC4)C4(C)C1(C)C(C)=C(C)C4(C)C32C(=O)OCC |
| InChI | InChI=1S/C24H35N2O4P/c1-8-29-18(27)23-20(5)15(3)16(4)21(6)22(20,7)17(26-13-11-10-12-14-26)25-31(23)24(21,23)19(28)30-9-2/h8-14H2,1-7H3 |
| InChIKey | KYZYTPPBEPVHJJ-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 68.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.53 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|