C32H28F8N3NiO4- — CID 10101443
[(2S)-1-benzylpyrrolidine-2-carbonyl]-[2-[N-[(1S,2R)-1-carboxy-3,3,4,4,5,5,6,6-octafluoro-2-hydroxyhexyl]-C-phenylcarbonimidoyl]phenyl]azanide;nickel (PubChem CID 10101443) has the molecular formula C32H28F8N3NiO4- and a molecular weight of 729.27 g/mol. Its IUPAC name is [(2S)-1-benzylpyrrolidine-2-carbonyl]-[2-[N-[(1S,2R)-1-carboxy-3,3,4,4,5,5,6,6-octafluoro-2-hydroxyhexyl]-C-phenylcarbonimidoyl]phenyl]azanide;nickel.
| Compound Name | [(2S)-1-benzylpyrrolidine-2-carbonyl]-[2-[N-[(1S,2R)-1-carboxy-3,3,4,4,5,5,6,6-octafluoro-2-hydroxyhexyl]-C-phenylcarbonimidoyl]phenyl]azanide;nickel |
|---|---|
| PubChem CID | 10101443 |
| Molecular Formula | C32H28F8N3NiO4- |
| Molecular Weight | 729.27 g/mol |
| Exact Mass | 728.13 |
| IUPAC Name | [(2S)-1-benzylpyrrolidine-2-carbonyl]-[2-[N-[(1S,2R)-1-carboxy-3,3,4,4,5,5,6,6-octafluoro-2-hydroxyhexyl]-C-phenylcarbonimidoyl]phenyl]azanide;nickel |
| SMILES | O=C(O)[C@@H](/N=C(/c1ccccc1)c1ccccc1[N-]C(=O)[C@@H]1CCCN1Cc1ccccc1)[C@@H](O)C(F)(F)C(F)(F)C(F)(F)C(F)F.[Ni] |
| InChI | InChI=1S/C32H29F8N3O4.Ni/c33-29(34)31(37,38)32(39,40)30(35,36)26(44)25(28(46)47)42-24(20-12-5-2-6-13-20)21-14-7-8-15-22(21)41-27(45)23-16-9-17-43(23)18-19-10-3-1-4-11-19;/h1-8,10-15,23,25-26,29,44H,9,16-18H2,(H2,41,42,45,46,47);/p-1/t23-,25-,26+;/m0./s1 |
| InChIKey | SMPHJNIWVYTIGQ-XKVNIVOBSA-M |
| XLogP | 6.70 |
| TPSA | 104.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 729.27 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|