C31H32N3NiO3- — CID 10506896
[(2S)-1-benzylpyrrolidine-2-carbonyl]-[2-[N-[(1S)-1-carboxypent-4-enyl]-C-phenylcarbonimidoyl]phenyl]azanide;nickel (PubChem CID 10506896) has the molecular formula C31H32N3NiO3- and a molecular weight of 553.31 g/mol. Its IUPAC name is [(2S)-1-benzylpyrrolidine-2-carbonyl]-[2-[N-[(1S)-1-carboxypent-4-enyl]-C-phenylcarbonimidoyl]phenyl]azanide;nickel.
| Compound Name | [(2S)-1-benzylpyrrolidine-2-carbonyl]-[2-[N-[(1S)-1-carboxypent-4-enyl]-C-phenylcarbonimidoyl]phenyl]azanide;nickel |
|---|---|
| PubChem CID | 10506896 |
| Molecular Formula | C31H32N3NiO3- |
| Molecular Weight | 553.31 g/mol |
| Exact Mass | 552.18 |
| IUPAC Name | [(2S)-1-benzylpyrrolidine-2-carbonyl]-[2-[N-[(1S)-1-carboxypent-4-enyl]-C-phenylcarbonimidoyl]phenyl]azanide;nickel |
| SMILES | C=CCC[C@H](/N=C(/c1ccccc1)c1ccccc1[N-]C(=O)[C@@H]1CCCN1Cc1ccccc1)C(=O)O.[Ni] |
| InChI | InChI=1S/C31H33N3O3.Ni/c1-2-3-18-27(31(36)37)32-29(24-15-8-5-9-16-24)25-17-10-11-19-26(25)33-30(35)28-20-12-21-34(28)22-23-13-6-4-7-14-23;/h2,4-11,13-17,19,27-28H,1,3,12,18,20-22H2,(H2,32,33,35,36,37);/p-1/t27-,28-;/m0./s1 |
| InChIKey | RARNXNRQHOEERM-DHBRAOIWSA-M |
| XLogP | 6.14 |
| TPSA | 84.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.31 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|