C32H34N3NiO3+ — CID 140747009
[(2S)-1-benzylpyrrolidine-2-carbonyl]-[2-[N-[(1R)-1-carboxyhex-5-ynyl]-C-cyclohexa-1,5-dien-1-ylcarbonimidoyl]phenyl]azanide;nickel(2+) (PubChem CID 140747009) has the molecular formula C32H34N3NiO3+ and a molecular weight of 567.34 g/mol. Its IUPAC name is [(2S)-1-benzylpyrrolidine-2-carbonyl]-[2-[N-[(1R)-1-carboxyhex-5-ynyl]-C-cyclohexa-1,5-dien-1-ylcarbonimidoyl]phenyl]azanide;nickel(2+).
| Compound Name | [(2S)-1-benzylpyrrolidine-2-carbonyl]-[2-[N-[(1R)-1-carboxyhex-5-ynyl]-C-cyclohexa-1,5-dien-1-ylcarbonimidoyl]phenyl]azanide;nickel(2+) |
|---|---|
| PubChem CID | 140747009 |
| Molecular Formula | C32H34N3NiO3+ |
| Molecular Weight | 567.34 g/mol |
| Exact Mass | 566.19 |
| IUPAC Name | [(2S)-1-benzylpyrrolidine-2-carbonyl]-[2-[N-[(1R)-1-carboxyhex-5-ynyl]-C-cyclohexa-1,5-dien-1-ylcarbonimidoyl]phenyl]azanide;nickel(2+) |
| SMILES | C#CCCC[C@@H](/N=C(\C1=CCCC=C1)c1ccccc1[N-]C(=O)[C@@H]1CCCN1Cc1ccccc1)C(=O)O.[Ni+2] |
| InChI | InChI=1S/C32H35N3O3.Ni/c1-2-3-6-20-28(32(37)38)33-30(25-16-9-5-10-17-25)26-18-11-12-19-27(26)34-31(36)29-21-13-22-35(29)23-24-14-7-4-8-15-24;/h1,4,7-9,11-12,14-19,28-29H,3,5-6,10,13,20-23H2,(H2,33,34,36,37,38);/q;+2/p-1/t28-,29+;/m1./s1 |
| InChIKey | UYQYEWACSZWXQD-XZVFQGBBSA-M |
| XLogP | 6.20 |
| TPSA | 84.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.34 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|