C27H24ClN3NiO3+ — CID 155291090
2-[[[2-[(2S)-1-benzylpyrrolidine-2-carbonyl]azanidyl-5-chlorophenyl]-phenylmethylidene]amino]acetate;nickel(3+) (PubChem CID 155291090) has the molecular formula C27H24ClN3NiO3+ and a molecular weight of 532.65 g/mol. Its IUPAC name is 2-[[[2-[(2S)-1-benzylpyrrolidine-2-carbonyl]azanidyl-5-chlorophenyl]-phenylmethylidene]amino]acetate;nickel(3+).
| Compound Name | 2-[[[2-[(2S)-1-benzylpyrrolidine-2-carbonyl]azanidyl-5-chlorophenyl]-phenylmethylidene]amino]acetate;nickel(3+) |
|---|---|
| PubChem CID | 155291090 |
| Molecular Formula | C27H24ClN3NiO3+ |
| Molecular Weight | 532.65 g/mol |
| Exact Mass | 531.09 |
| IUPAC Name | 2-[[[2-[(2S)-1-benzylpyrrolidine-2-carbonyl]azanidyl-5-chlorophenyl]-phenylmethylidene]amino]acetate;nickel(3+) |
| SMILES | O=C([O-])C/N=C(\c1ccccc1)c1cc(Cl)ccc1[N-]C(=O)[C@@H]1CCCN1Cc1ccccc1.[Ni+3] |
| InChI | InChI=1S/C27H26ClN3O3.Ni/c28-21-13-14-23(22(16-21)26(29-17-25(32)33)20-10-5-2-6-11-20)30-27(34)24-12-7-15-31(24)18-19-8-3-1-4-9-19;/h1-6,8-11,13-14,16,24H,7,12,15,17-18H2,(H2,29,30,32,33,34);/q;+3/p-2/t24-;/m0./s1 |
| InChIKey | WIWAPGLZOMJJLI-JIDHJSLPSA-L |
| XLogP | 4.12 |
| TPSA | 86.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.65 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|