C54H52N6NiO6 — CID 139211162
bis(1-benzyl-N-[2-[N-(carboxymethyl)-C-phenylcarbonimidoyl]phenyl]pyrrolidine-2-carboximidate);nickel(2+) (PubChem CID 139211162) has the molecular formula C54H52N6NiO6 and a molecular weight of 939.74 g/mol. Its IUPAC name is bis(1-benzyl-N-[2-[N-(carboxymethyl)-C-phenylcarbonimidoyl]phenyl]pyrrolidine-2-carboximidate);nickel(2+).
| Compound Name | bis(1-benzyl-N-[2-[N-(carboxymethyl)-C-phenylcarbonimidoyl]phenyl]pyrrolidine-2-carboximidate);nickel(2+) |
|---|---|
| PubChem CID | 139211162 |
| Molecular Formula | C54H52N6NiO6 |
| Molecular Weight | 939.74 g/mol |
| Exact Mass | 938.33 |
| IUPAC Name | bis(1-benzyl-N-[2-[N-(carboxymethyl)-C-phenylcarbonimidoyl]phenyl]pyrrolidine-2-carboximidate);nickel(2+) |
| SMILES | O=C(O)C/N=C(\c1ccccc1)c1ccccc1/N=C(/[O-])C1CCCN1Cc1ccccc1.O=C(O)C/N=C(\c1ccccc1)c1ccccc1/N=C(\[O-])C1CCCN1Cc1ccccc1.[Ni+2] |
| InChI | InChI=1S/2C27H27N3O3.Ni/c2*31-25(32)18-28-26(21-12-5-2-6-13-21)22-14-7-8-15-23(22)29-27(33)24-16-9-17-30(24)19-20-10-3-1-4-11-20;/h2*1-8,10-15,24H,9,16-19H2,(H,29,33)(H,31,32);/q;;+2/p-2/b2*28-26+; |
| InChIKey | AOPRZZXNTUCPMK-PLTQLCHKSA-L |
| XLogP | 7.32 |
| TPSA | 176.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 67 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 939.74 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|