C28H27N3NiO3S — CID 51354382
2-[[[2-[[[(2S)-1-[(2-methylsulfanylphenyl)methyl]pyrrolidin-2-yl]-oxidomethylidene]amino]phenyl]-phenylmethylidene]amino]acetate;nickel(2+) (PubChem CID 51354382) has the molecular formula C28H27N3NiO3S and a molecular weight of 544.30 g/mol. Its IUPAC name is 2-[[[2-[[[(2S)-1-[(2-methylsulfanylphenyl)methyl]pyrrolidin-2-yl]-oxidomethylidene]amino]phenyl]-phenylmethylidene]amino]acetate;nickel(2+).
| Compound Name | 2-[[[2-[[[(2S)-1-[(2-methylsulfanylphenyl)methyl]pyrrolidin-2-yl]-oxidomethylidene]amino]phenyl]-phenylmethylidene]amino]acetate;nickel(2+) |
|---|---|
| PubChem CID | 51354382 |
| Molecular Formula | C28H27N3NiO3S |
| Molecular Weight | 544.30 g/mol |
| Exact Mass | 543.11 |
| IUPAC Name | 2-[[[2-[[[(2S)-1-[(2-methylsulfanylphenyl)methyl]pyrrolidin-2-yl]-oxidomethylidene]amino]phenyl]-phenylmethylidene]amino]acetate;nickel(2+) |
| SMILES | CSc1ccccc1CN1CCC[C@H]1/C([O-])=N/c1ccccc1/C(=N/CC(=O)[O-])c1ccccc1.[Ni+2] |
| InChI | InChI=1S/C28H29N3O3S.Ni/c1-35-25-16-8-5-12-21(25)19-31-17-9-15-24(31)28(34)30-23-14-7-6-13-22(23)27(29-18-26(32)33)20-10-3-2-4-11-20;/h2-8,10-14,16,24H,9,15,17-19H2,1H3,(H,30,34)(H,32,33);/q;+2/p-2/b29-27+;/t24-;/m0./s1 |
| InChIKey | IADPVVCLALNGRI-SDRGYGPRSA-L |
| XLogP | 3.05 |
| TPSA | 91.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.30 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|