C26H26N2O2S — CID 51354096
(2S)-N-(2-benzoylphenyl)-1-[(2-methylsulfanylphenyl)methyl]pyrrolidine-2-carboxamide (PubChem CID 51354096) has the molecular formula C26H26N2O2S and a molecular weight of 430.57 g/mol. Its IUPAC name is (2S)-N-(2-benzoylphenyl)-1-[(2-methylsulfanylphenyl)methyl]pyrrolidine-2-carboxamide.
| Compound Name | (2S)-N-(2-benzoylphenyl)-1-[(2-methylsulfanylphenyl)methyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 51354096 |
| Molecular Formula | C26H26N2O2S |
| Molecular Weight | 430.57 g/mol |
| Exact Mass | 430.17 |
| IUPAC Name | (2S)-N-(2-benzoylphenyl)-1-[(2-methylsulfanylphenyl)methyl]pyrrolidine-2-carboxamide |
| SMILES | CSc1ccccc1CN1CCC[C@H]1C(=O)Nc1ccccc1C(=O)c1ccccc1 |
| InChI | InChI=1S/C26H26N2O2S/c1-31-24-16-8-5-12-20(24)18-28-17-9-15-23(28)26(30)27-22-14-7-6-13-21(22)25(29)19-10-3-2-4-11-19/h2-8,10-14,16,23H,9,15,17-18H2,1H3,(H,27,30)/t23-/m0/s1 |
| InChIKey | FZDPKKREJNRVHQ-QHCPKHFHSA-N |
| XLogP | 5.24 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.57 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |